C22H29N5O5S — CID 135730228
3-(8-cyclopentyl-6-methyl-4-oxo-3H-imidazo[1,5-a][1,3,5]triazin-2-yl)-4-ethoxy-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 135730228) has the molecular formula C22H29N5O5S and a molecular weight of 475.57 g/mol. Its IUPAC name is 3-(8-cyclopentyl-6-methyl-4-oxo-3H-imidazo[1,5-a][1,3,5]triazin-2-yl)-4-ethoxy-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 3-(8-cyclopentyl-6-methyl-4-oxo-3H-imidazo[1,5-a][1,3,5]triazin-2-yl)-4-ethoxy-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 135730228 |
| Molecular Formula | C22H29N5O5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 3-(8-cyclopentyl-6-methyl-4-oxo-3H-imidazo[1,5-a][1,3,5]triazin-2-yl)-4-ethoxy-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCOC)cc1-c1nc2c(C3CCCC3)nc(C)n2c(=O)[nH]1 |
| InChI | InChI=1S/C22H29N5O5S/c1-4-32-18-10-9-16(33(29,30)23-11-12-31-3)13-17(18)20-25-21-19(15-7-5-6-8-15)24-14(2)27(21)22(28)26-20/h9-10,13,15,23H,4-8,11-12H2,1-3H3,(H,25,26,28) |
| InChIKey | AHPNRDQEDXAYDS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|