C15H26N4O2 — CID 135730282
1-(4-heptan-3-yl-6-oxo-1H-pyrimidin-2-yl)-3-propylurea (PubChem CID 135730282) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-(4-heptan-3-yl-6-oxo-1H-pyrimidin-2-yl)-3-propylurea.
| Compound Name | 1-(4-heptan-3-yl-6-oxo-1H-pyrimidin-2-yl)-3-propylurea |
|---|---|
| PubChem CID | 135730282 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-(4-heptan-3-yl-6-oxo-1H-pyrimidin-2-yl)-3-propylurea |
| SMILES | CCCCC(CC)c1cc(=O)[nH]c(NC(=O)NCCC)n1 |
| InChI | InChI=1S/C15H26N4O2/c1-4-7-8-11(6-3)12-10-13(20)18-14(17-12)19-15(21)16-9-5-2/h10-11H,4-9H2,1-3H3,(H3,16,17,18,19,20,21) |
| InChIKey | NHDJGHWEXFQTGH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |