About fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one
fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one (PubChem CID 135731613) has the molecular formula C8H11FmNO3
and a molecular weight of 426.18 g/mol. Its IUPAC name is fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one.
Molecular Properties
| Compound Name | fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one |
| PubChem CID | 135731613 |
| Molecular Formula | C8H11FmNO3 |
| Molecular Weight | 426.18 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one |
| SMILES | CC1CCCC12N=C(O)OC2=O.[Fm] |
| InChI | InChI=1S/C8H11NO3.Fm/c1-5-3-2-4-8(5)6(10)12-7(11)9-8;/h5H,2-4H2,1H3,(H,9,11); |
| InChIKey | KLAPPERWYOFGBW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one?
The IUPAC name of fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one (CID 135731613) is fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one.
What is the SMILES notation for fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one?
The canonical SMILES for fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one is CC1CCCC12N=C(O)OC2=O.[Fm].
What is the InChIKey of fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one?
The InChIKey is KLAPPERWYOFGBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3.Fm/c1-5-3-2-4-8(5)6(10)12-7(11)9-8;/h5H,2-4H2,1H3,(H,9,11);.
What are the key properties of fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one?
fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one has a molecular weight of 426.18 g/mol, XLogP of 1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fermium;2-hydroxy-9-methyl-3-oxa-1-azaspiro[4.4]non-1-en-4-one is sourced from PubChem (CID 135731613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).