C11H11N7O2S3 — CID 135731945
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4-oxo-1,5-dihydropyrazolo[5,4-d]pyrimidin-6-yl)sulfanyl]acetamide (PubChem CID 135731945) has the molecular formula C11H11N7O2S3 and a molecular weight of 369.46 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4-oxo-1,5-dihydropyrazolo[5,4-d]pyrimidin-6-yl)sulfanyl]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4-oxo-1,5-dihydropyrazolo[5,4-d]pyrimidin-6-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 135731945 |
| Molecular Formula | C11H11N7O2S3 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4-oxo-1,5-dihydropyrazolo[5,4-d]pyrimidin-6-yl)sulfanyl]acetamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nc3[nH]ncc3c(=O)[nH]2)s1 |
| InChI | InChI=1S/C11H11N7O2S3/c1-2-21-11-18-17-10(23-11)13-6(19)4-22-9-14-7-5(3-12-16-7)8(20)15-9/h3H,2,4H2,1H3,(H,13,17,19)(H2,12,14,15,16,20) |
| InChIKey | UTNPXZVADFMUBY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|