C13H17N3S — CID 135732235
N-methyl-5-(4-propylphenyl)-3,4-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135732235) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is N-methyl-5-(4-propylphenyl)-3,4-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-methyl-5-(4-propylphenyl)-3,4-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135732235 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-methyl-5-(4-propylphenyl)-3,4-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | CCCc1ccc(C2=CS/C(=N\C)NN2)cc1 |
| InChI | InChI=1S/C13H17N3S/c1-3-4-10-5-7-11(8-6-10)12-9-17-13(14-2)16-15-12/h5-9,15H,3-4H2,1-2H3,(H,14,16) |
| InChIKey | REPYKCWCXUERCR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|