C11H15N3O2 — CID 135732763
ethyl (E)-3-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl)prop-2-enoate (PubChem CID 135732763) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is ethyl (E)-3-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 135732763 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | ethyl (E)-3-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cnn2c1NCCC2 |
| InChI | InChI=1S/C11H15N3O2/c1-2-16-10(15)5-4-9-8-13-14-7-3-6-12-11(9)14/h4-5,8,12H,2-3,6-7H2,1H3/b5-4+ |
| InChIKey | PGMSIPPHUYHSEA-SNAWJCMRSA-N |
| XLogP | 1.27 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|