C19H19N3O4 — CID 135735447
(Z)-N-[2-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 135735447) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is (Z)-N-[2-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[2-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 135735447 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (Z)-N-[2-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | COc1cccc(/C=N/NC(=O)CNC(=O)/C=C\c2ccccc2)c1O |
| InChI | InChI=1S/C19H19N3O4/c1-26-16-9-5-8-15(19(16)25)12-21-22-18(24)13-20-17(23)11-10-14-6-3-2-4-7-14/h2-12,25H,13H2,1H3,(H,20,23)(H,22,24)/b11-10-,21-12+ |
| InChIKey | VQRRSATXHPCJII-DLNWUCCESA-N |
| XLogP | 1.68 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|