C10H17NO6 — CID 135735782
(2S,4R)-2-amino-4-(3-methoxy-2-methyl-3-oxopropyl)pentanedioic acid (PubChem CID 135735782) has the molecular formula C10H17NO6 and a molecular weight of 247.25 g/mol. Its IUPAC name is (2S,4R)-2-amino-4-(3-methoxy-2-methyl-3-oxopropyl)pentanedioic acid.
| Compound Name | (2S,4R)-2-amino-4-(3-methoxy-2-methyl-3-oxopropyl)pentanedioic acid |
|---|---|
| PubChem CID | 135735782 |
| Molecular Formula | C10H17NO6 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | (2S,4R)-2-amino-4-(3-methoxy-2-methyl-3-oxopropyl)pentanedioic acid |
| SMILES | COC(=O)C(C)C[C@H](C[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17NO6/c1-5(10(16)17-2)3-6(8(12)13)4-7(11)9(14)15/h5-7H,3-4,11H2,1-2H3,(H,12,13)(H,14,15)/t5?,6-,7+/m1/s1 |
| InChIKey | DROJCALKZUUUKJ-FWPZAIACSA-N |
| XLogP | -0.31 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |