C10H15NO4 — CID 59879625
dimethyl (2R,4S)-2-(isocyanomethyl)-4-methylpentanedioate (PubChem CID 59879625) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is dimethyl (2R,4S)-2-(isocyanomethyl)-4-methylpentanedioate.
| Compound Name | dimethyl (2R,4S)-2-(isocyanomethyl)-4-methylpentanedioate |
|---|---|
| PubChem CID | 59879625 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | dimethyl (2R,4S)-2-(isocyanomethyl)-4-methylpentanedioate |
| SMILES | [C-]#[N+]C[C@@H](C[C@H](C)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C10H15NO4/c1-7(9(12)14-3)5-8(6-11-2)10(13)15-4/h7-8H,5-6H2,1,3-4H3/t7-,8+/m0/s1 |
| InChIKey | GXKGLXJTZOTQFR-JGVFFNPUSA-N |
| XLogP | 0.89 |
| TPSA | 56.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|