C10H20O3 — CID 85176475
methyl 6-hydroxy-2,4-dimethylheptanoate (PubChem CID 85176475) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is methyl 6-hydroxy-2,4-dimethylheptanoate.
| Compound Name | methyl 6-hydroxy-2,4-dimethylheptanoate |
|---|---|
| PubChem CID | 85176475 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | methyl 6-hydroxy-2,4-dimethylheptanoate |
| SMILES | COC(=O)C(C)CC(C)CC(C)O |
| InChI | InChI=1S/C10H20O3/c1-7(6-9(3)11)5-8(2)10(12)13-4/h7-9,11H,5-6H2,1-4H3 |
| InChIKey | DKLYCLXAHDLYOB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |