C23H30N6O2 — CID 135740545
3-benzyl-5-[(3R)-1-heptanoylpiperidin-3-yl]-6H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 135740545) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-benzyl-5-[(3R)-1-heptanoylpiperidin-3-yl]-6H-triazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3-benzyl-5-[(3R)-1-heptanoylpiperidin-3-yl]-6H-triazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135740545 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 3-benzyl-5-[(3R)-1-heptanoylpiperidin-3-yl]-6H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCCCCCC(=O)N1CCC[C@@H](c2nc3c(nnn3Cc3ccccc3)c(=O)[nH]2)C1 |
| InChI | InChI=1S/C23H30N6O2/c1-2-3-4-8-13-19(30)28-14-9-12-18(16-28)21-24-22-20(23(31)25-21)26-27-29(22)15-17-10-6-5-7-11-17/h5-7,10-11,18H,2-4,8-9,12-16H2,1H3,(H,24,25,31)/t18-/m1/s1 |
| InChIKey | RLYBFYYMLMZHGE-GOSISDBHSA-N |
| XLogP | 3.24 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|