C8H8N4O2 — CID 135742612
6-ethoxy-3H-pteridin-4-one (PubChem CID 135742612) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is 6-ethoxy-3H-pteridin-4-one.
| Compound Name | 6-ethoxy-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135742612 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 6-ethoxy-3H-pteridin-4-one |
| SMILES | CCOc1cnc2nc[nH]c(=O)c2n1 |
| InChI | InChI=1S/C8H8N4O2/c1-2-14-5-3-9-7-6(12-5)8(13)11-4-10-7/h3-4H,2H2,1H3,(H,9,10,11,13) |
| InChIKey | DJPBBZAAKRTUER-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |