C9H10N4O3 — CID 822210
7-methoxy-1,3-dimethylpteridine-2,4-dione (PubChem CID 822210) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is 7-methoxy-1,3-dimethylpteridine-2,4-dione.
| Compound Name | 7-methoxy-1,3-dimethylpteridine-2,4-dione |
|---|---|
| PubChem CID | 822210 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 7-methoxy-1,3-dimethylpteridine-2,4-dione |
| SMILES | COc1cnc2c(=O)n(C)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C9H10N4O3/c1-12-7-6(8(14)13(2)9(12)15)10-4-5(11-7)16-3/h4H,1-3H3 |
| InChIKey | KTPQWFJVGWFJDN-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |