About 1-propylpteridine-2,4-dione
1-propylpteridine-2,4-dione (PubChem CID 10584387) has the molecular formula C9H10N4O2
and a molecular weight of 206.21 g/mol. Its IUPAC name is 1-propylpteridine-2,4-dione.
Molecular Properties
| Compound Name | 1-propylpteridine-2,4-dione |
| PubChem CID | 10584387 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 1-propylpteridine-2,4-dione |
| SMILES | CCCn1c(=O)[nH]c(=O)c2nccnc21 |
| InChI | InChI=1S/C9H10N4O2/c1-2-5-13-7-6(10-3-4-11-7)8(14)12-9(13)15/h3-4H,2,5H2,1H3,(H,12,14,15) |
| InChIKey | JYFXGCWMOFDIPR-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-propylpteridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propylpteridine-2,4-dione?
The IUPAC name of 1-propylpteridine-2,4-dione (CID 10584387) is 1-propylpteridine-2,4-dione.
What is the SMILES notation for 1-propylpteridine-2,4-dione?
The canonical SMILES for 1-propylpteridine-2,4-dione is CCCn1c(=O)[nH]c(=O)c2nccnc21.
What is the InChIKey of 1-propylpteridine-2,4-dione?
The InChIKey is JYFXGCWMOFDIPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-2-5-13-7-6(10-3-4-11-7)8(14)12-9(13)15/h3-4H,2,5H2,1H3,(H,12,14,15).
What are the key properties of 1-propylpteridine-2,4-dione?
1-propylpteridine-2,4-dione has a molecular weight of 206.21 g/mol, XLogP of -0.11, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propylpteridine-2,4-dione is sourced from PubChem (CID 10584387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).