C15H18N3O+ — CID 135743752
N-[(2-piperidin-1-ylquinolin-1-ium-3-yl)methylidene]hydroxylamine (PubChem CID 135743752) has the molecular formula C15H18N3O+ and a molecular weight of 256.33 g/mol. Its IUPAC name is N-[(2-piperidin-1-ylquinolin-1-ium-3-yl)methylidene]hydroxylamine.
| Compound Name | N-[(2-piperidin-1-ylquinolin-1-ium-3-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135743752 |
| Molecular Formula | C15H18N3O+ |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-[(2-piperidin-1-ylquinolin-1-ium-3-yl)methylidene]hydroxylamine |
| SMILES | ON=Cc1cc2ccccc2[nH+]c1N1CCCCC1 |
| InChI | InChI=1S/C15H17N3O/c19-16-11-13-10-12-6-2-3-7-14(12)17-15(13)18-8-4-1-5-9-18/h2-3,6-7,10-11,19H,1,4-5,8-9H2/p+1 |
| InChIKey | YHVCGSGZRMOVNQ-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 49.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|