C24H23N4O3+ — CID 9291824
(E)-2-cyano-N-(3-methoxyphenyl)-3-(2-morpholin-4-ylquinolin-1-ium-3-yl)prop-2-enamide (PubChem CID 9291824) has the molecular formula C24H23N4O3+ and a molecular weight of 415.47 g/mol. Its IUPAC name is (E)-2-cyano-N-(3-methoxyphenyl)-3-(2-morpholin-4-ylquinolin-1-ium-3-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3-methoxyphenyl)-3-(2-morpholin-4-ylquinolin-1-ium-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9291824 |
| Molecular Formula | C24H23N4O3+ |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (E)-2-cyano-N-(3-methoxyphenyl)-3-(2-morpholin-4-ylquinolin-1-ium-3-yl)prop-2-enamide |
| SMILES | COc1cccc(NC(=O)/C(C#N)=C/c2cc3ccccc3[nH+]c2N2CCOCC2)c1 |
| InChI | InChI=1S/C24H22N4O3/c1-30-21-7-4-6-20(15-21)26-24(29)19(16-25)14-18-13-17-5-2-3-8-22(17)27-23(18)28-9-11-31-12-10-28/h2-8,13-15H,9-12H2,1H3,(H,26,29)/p+1/b19-14+ |
| InChIKey | YWUXGXIYKSEBTF-XMHGGMMESA-O |
| XLogP | 3.04 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|