C50H38N4O4 — CID 135745374
methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 135745374) has the molecular formula C50H38N4O4 and a molecular weight of 758.88 g/mol. Its IUPAC name is methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 135745374 |
| Molecular Formula | C50H38N4O4 |
| Molecular Weight | 758.88 g/mol |
| Exact Mass | 758.29 |
| IUPAC Name | methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)OC)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C50H38N4O4/c1-29-5-9-31(10-6-29)45-37-21-25-41(51-37)47(33-13-17-35(18-14-33)49(55)57-3)43-27-23-39(53-43)46(32-11-7-30(2)8-12-32)40-24-28-44(54-40)48(42-26-22-38(45)52-42)34-15-19-36(20-16-34)50(56)58-4/h5-28,51,54H,1-4H3/b45-37-,45-38-,46-39-,46-40-,47-41-,47-43-,48-42-,48-44- |
| InChIKey | QWECJAOIFHGRGB-ZNSTUQKDSA-N |
| XLogP | 11.51 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.88 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |