C23H23Cl2N5O — CID 135745743
2-(4-tert-butylphenyl)-7-(2,4-dichlorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135745743) has the molecular formula C23H23Cl2N5O and a molecular weight of 456.38 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-7-(2,4-dichlorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(4-tert-butylphenyl)-7-(2,4-dichlorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135745743 |
| Molecular Formula | C23H23Cl2N5O |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-(4-tert-butylphenyl)-7-(2,4-dichlorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(N)=O)C(c2ccc(Cl)cc2Cl)n2nc(-c3ccc(C(C)(C)C)cc3)nc2N1 |
| InChI | InChI=1S/C23H23Cl2N5O/c1-12-18(20(26)31)19(16-10-9-15(24)11-17(16)25)30-22(27-12)28-21(29-30)13-5-7-14(8-6-13)23(2,3)4/h5-11,19H,1-4H3,(H2,26,31)(H,27,28,29) |
| InChIKey | KKNVJWRYIDTFMY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |