C23H22Cl2N4O4 — CID 135798768
ethyl 7-(2,4-dichlorophenyl)-2-(3,4-dimethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135798768) has the molecular formula C23H22Cl2N4O4 and a molecular weight of 489.36 g/mol. Its IUPAC name is ethyl 7-(2,4-dichlorophenyl)-2-(3,4-dimethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-(2,4-dichlorophenyl)-2-(3,4-dimethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135798768 |
| Molecular Formula | C23H22Cl2N4O4 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | ethyl 7-(2,4-dichlorophenyl)-2-(3,4-dimethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(-c3ccc(OC)c(OC)c3)nn2C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H22Cl2N4O4/c1-5-33-22(30)19-12(2)26-23-27-21(13-6-9-17(31-3)18(10-13)32-4)28-29(23)20(19)15-8-7-14(24)11-16(15)25/h6-11,20H,5H2,1-4H3,(H,26,27,28) |
| InChIKey | ZLMLWJHLFVAZAE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |