C17H13F2N3O3S — CID 135747634
4-[6-amino-5-(3,5-difluoro-4-hydroxyphenyl)-3-pyridinyl]benzenesulfonamide (PubChem CID 135747634) has the molecular formula C17H13F2N3O3S and a molecular weight of 377.37 g/mol. Its IUPAC name is 4-[6-amino-5-(3,5-difluoro-4-hydroxyphenyl)-3-pyridinyl]benzenesulfonamide.
| Compound Name | 4-[6-amino-5-(3,5-difluoro-4-hydroxyphenyl)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135747634 |
| Molecular Formula | C17H13F2N3O3S |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 4-[6-amino-5-(3,5-difluoro-4-hydroxyphenyl)-3-pyridinyl]benzenesulfonamide |
| SMILES | Nc1ncc(-c2ccc(S(N)(=O)=O)cc2)cc1-c1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C17H13F2N3O3S/c18-14-6-10(7-15(19)16(14)23)13-5-11(8-22-17(13)20)9-1-3-12(4-2-9)26(21,24)25/h1-8,23H,(H2,20,22)(H2,21,24,25) |
| InChIKey | MTBXQYCZMOAADV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |