C10H11ClN6O3 — CID 135748085
N-[(4-chloro-1-methylpyrazol-5-yl)methyl]-N-methyl-5-nitro-1H-pyrazole-3-carboxamide (PubChem CID 135748085) has the molecular formula C10H11ClN6O3 and a molecular weight of 298.69 g/mol. Its IUPAC name is N-[(4-chloro-1-methylpyrazol-5-yl)methyl]-N-methyl-5-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(4-chloro-1-methylpyrazol-5-yl)methyl]-N-methyl-5-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135748085 |
| Molecular Formula | C10H11ClN6O3 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-[(4-chloro-1-methylpyrazol-5-yl)methyl]-N-methyl-5-nitro-1H-pyrazole-3-carboxamide |
| SMILES | CN(Cc1c(Cl)cnn1C)C(=O)c1cc([N+](=O)[O-])[nH]n1 |
| InChI | InChI=1S/C10H11ClN6O3/c1-15(5-8-6(11)4-12-16(8)2)10(18)7-3-9(14-13-7)17(19)20/h3-4H,5H2,1-2H3,(H,13,14) |
| InChIKey | RBKDIPJQKMTCQG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|