C19H19ClN4O5 — CID 19460542
N-[(4-chloro-1-methylpyrazol-5-yl)methyl]-N-methyl-5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide (PubChem CID 19460542) has the molecular formula C19H19ClN4O5 and a molecular weight of 418.84 g/mol. Its IUPAC name is N-[(4-chloro-1-methylpyrazol-5-yl)methyl]-N-methyl-5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[(4-chloro-1-methylpyrazol-5-yl)methyl]-N-methyl-5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19460542 |
| Molecular Formula | C19H19ClN4O5 |
| Molecular Weight | 418.84 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | N-[(4-chloro-1-methylpyrazol-5-yl)methyl]-N-methyl-5-[(4-methyl-2-nitrophenoxy)methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(OCc2ccc(C(=O)N(C)Cc3c(Cl)cnn3C)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19ClN4O5/c1-12-4-6-17(15(8-12)24(26)27)28-11-13-5-7-18(29-13)19(25)22(2)10-16-14(20)9-21-23(16)3/h4-9H,10-11H2,1-3H3 |
| InChIKey | OFMQDPWFZAFEBS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 103.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.84 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|