C15H23N5O5 — CID 135748230
(8R)-9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-piperidin-1-yl-7,8-dihydro-1H-purin-6-one (PubChem CID 135748230) has the molecular formula C15H23N5O5 and a molecular weight of 353.38 g/mol. Its IUPAC name is (8R)-9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-piperidin-1-yl-7,8-dihydro-1H-purin-6-one.
| Compound Name | (8R)-9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-piperidin-1-yl-7,8-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 135748230 |
| Molecular Formula | C15H23N5O5 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (8R)-9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-piperidin-1-yl-7,8-dihydro-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1N[C@H](N1CCCCC1)N2[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H23N5O5/c21-6-8-10(22)11(23)14(25-8)20-12-9(13(24)17-7-16-12)18-15(20)19-4-2-1-3-5-19/h7-8,10-11,14-15,18,21-23H,1-6H2,(H,16,17,24)/t8-,10-,11+,14-,15-/m1/s1 |
| InChIKey | MXNSKMKMAWBTHM-UJJBCWTCSA-N |
| XLogP | -1.79 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |