C21H21N5O4 — CID 135749375
7-(2,4-dimethoxyphenyl)-2-(4-hydroxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135749375) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is 7-(2,4-dimethoxyphenyl)-2-(4-hydroxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(2,4-dimethoxyphenyl)-2-(4-hydroxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135749375 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 7-(2,4-dimethoxyphenyl)-2-(4-hydroxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(C2C(C(N)=O)=C(C)Nc3nc(-c4ccc(O)cc4)nn32)c(OC)c1 |
| InChI | InChI=1S/C21H21N5O4/c1-11-17(19(22)28)18(15-9-8-14(29-2)10-16(15)30-3)26-21(23-11)24-20(25-26)12-4-6-13(27)7-5-12/h4-10,18,27H,1-3H3,(H2,22,28)(H,23,24,25) |
| InChIKey | ZDECUHJKORATAE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |