C21H20N6O5 — CID 135600775
7-(2,4-dimethoxyphenyl)-5-methyl-2-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135600775) has the molecular formula C21H20N6O5 and a molecular weight of 436.43 g/mol. Its IUPAC name is 7-(2,4-dimethoxyphenyl)-5-methyl-2-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(2,4-dimethoxyphenyl)-5-methyl-2-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135600775 |
| Molecular Formula | C21H20N6O5 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 7-(2,4-dimethoxyphenyl)-5-methyl-2-(4-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(C2C(C(N)=O)=C(C)Nc3nc(-c4ccc([N+](=O)[O-])cc4)nn32)c(OC)c1 |
| InChI | InChI=1S/C21H20N6O5/c1-11-17(19(22)28)18(15-9-8-14(31-2)10-16(15)32-3)26-21(23-11)24-20(25-26)12-4-6-13(7-5-12)27(29)30/h4-10,18H,1-3H3,(H2,22,28)(H,23,24,25) |
| InChIKey | VIKCXEHDPJJWBF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|