C22H22N6O6 — CID 135709943
5-methyl-2-(3-nitrophenyl)-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135709943) has the molecular formula C22H22N6O6 and a molecular weight of 466.45 g/mol. Its IUPAC name is 5-methyl-2-(3-nitrophenyl)-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-2-(3-nitrophenyl)-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135709943 |
| Molecular Formula | C22H22N6O6 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 5-methyl-2-(3-nitrophenyl)-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(C2C(C(N)=O)=C(C)Nc3nc(-c4cccc([N+](=O)[O-])c4)nn32)cc(OC)c1OC |
| InChI | InChI=1S/C22H22N6O6/c1-11-17(20(23)29)18(13-9-15(32-2)19(34-4)16(10-13)33-3)27-22(24-11)25-21(26-27)12-6-5-7-14(8-12)28(30)31/h5-10,18H,1-4H3,(H2,23,29)(H,24,25,26) |
| InChIKey | IKACNXZKYRRYSH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|