C19H14Cl2N6O3 — CID 135723287
7-(2,3-dichlorophenyl)-5-methyl-2-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135723287) has the molecular formula C19H14Cl2N6O3 and a molecular weight of 445.27 g/mol. Its IUPAC name is 7-(2,3-dichlorophenyl)-5-methyl-2-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(2,3-dichlorophenyl)-5-methyl-2-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135723287 |
| Molecular Formula | C19H14Cl2N6O3 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 7-(2,3-dichlorophenyl)-5-methyl-2-(3-nitrophenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(N)=O)C(c2cccc(Cl)c2Cl)n2nc(-c3cccc([N+](=O)[O-])c3)nc2N1 |
| InChI | InChI=1S/C19H14Cl2N6O3/c1-9-14(17(22)28)16(12-6-3-7-13(20)15(12)21)26-19(23-9)24-18(25-26)10-4-2-5-11(8-10)27(29)30/h2-8,16H,1H3,(H2,22,28)(H,23,24,25) |
| InChIKey | RCJQKXQJBDXGCL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|