C28H22N8 — CID 135750035
(5E)-15-(1-methylimidazol-2-yl)-5-(3-methyl-1H-imidazol-2-ylidene)-21H-porphyrin (PubChem CID 135750035) has the molecular formula C28H22N8 and a molecular weight of 470.54 g/mol. Its IUPAC name is (5E)-15-(1-methylimidazol-2-yl)-5-(3-methyl-1H-imidazol-2-ylidene)-21H-porphyrin.
| Compound Name | (5E)-15-(1-methylimidazol-2-yl)-5-(3-methyl-1H-imidazol-2-ylidene)-21H-porphyrin |
|---|---|
| PubChem CID | 135750035 |
| Molecular Formula | C28H22N8 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | (5E)-15-(1-methylimidazol-2-yl)-5-(3-methyl-1H-imidazol-2-ylidene)-21H-porphyrin |
| SMILES | CN1C=CN/C1=C1\C2=N/C(=C\C3=N/C(=C(/c4nccn4C)C4=N/C(=C\c5ccc1[nH]5)C=C4)C=C3)C=C2 |
| InChI | InChI=1S/C28H22N8/c1-35-13-11-29-27(35)25-21-7-3-17(31-21)15-19-5-9-23(33-19)26(28-30-12-14-36(28)2)24-10-6-20(34-24)16-18-4-8-22(25)32-18/h3-16,29,31H,1-2H3/b18-16-,19-15-,26-24+,27-25+ |
| InChIKey | AHQDUYIXOSYLLX-GOYMELIOSA-N |
| XLogP | 4.11 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |