C25H22N2O3 — CID 135750229
methyl (Z)-2-(4,4-diphenyl-1H-quinazolin-2-yl)-3-hydroxybut-2-enoate (PubChem CID 135750229) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is methyl (Z)-2-(4,4-diphenyl-1H-quinazolin-2-yl)-3-hydroxybut-2-enoate.
| Compound Name | methyl (Z)-2-(4,4-diphenyl-1H-quinazolin-2-yl)-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135750229 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | methyl (Z)-2-(4,4-diphenyl-1H-quinazolin-2-yl)-3-hydroxybut-2-enoate |
| SMILES | COC(=O)/C(C1=NC(c2ccccc2)(c2ccccc2)c2ccccc2N1)=C(/C)O |
| InChI | InChI=1S/C25H22N2O3/c1-17(28)22(24(29)30-2)23-26-21-16-10-9-15-20(21)25(27-23,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-16,28H,1-2H3,(H,26,27)/b22-17- |
| InChIKey | WQZGDYVHDAZLPA-XLNRJJMWSA-N |
| XLogP | 4.81 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|