C30H32N2O3 — CID 135929965
ethyl 2-(4,4-diphenyl-1H-quinazolin-2-yl)-3-hydroxyoct-2-enoate (PubChem CID 135929965) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is ethyl 2-(4,4-diphenyl-1H-quinazolin-2-yl)-3-hydroxyoct-2-enoate.
| Compound Name | ethyl 2-(4,4-diphenyl-1H-quinazolin-2-yl)-3-hydroxyoct-2-enoate |
|---|---|
| PubChem CID | 135929965 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | ethyl 2-(4,4-diphenyl-1H-quinazolin-2-yl)-3-hydroxyoct-2-enoate |
| SMILES | CCCCCC(O)=C(C(=O)OCC)C1=NC(c2ccccc2)(c2ccccc2)c2ccccc2N1 |
| InChI | InChI=1S/C30H32N2O3/c1-3-5-8-21-26(33)27(29(34)35-4-2)28-31-25-20-14-13-19-24(25)30(32-28,22-15-9-6-10-16-22)23-17-11-7-12-18-23/h6-7,9-20,33H,3-5,8,21H2,1-2H3,(H,31,32) |
| InChIKey | QVJMLHRKWWRWNH-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|