C19H17N5O7 — CID 135751960
N-[(E)-(2-hydroxy-5-methoxy-3-nitrophenyl)methylideneamino]-2-(2-methyl-4-oxoquinazolin-3-yl)oxyacetamide (PubChem CID 135751960) has the molecular formula C19H17N5O7 and a molecular weight of 427.37 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-5-methoxy-3-nitrophenyl)methylideneamino]-2-(2-methyl-4-oxoquinazolin-3-yl)oxyacetamide.
| Compound Name | N-[(E)-(2-hydroxy-5-methoxy-3-nitrophenyl)methylideneamino]-2-(2-methyl-4-oxoquinazolin-3-yl)oxyacetamide |
|---|---|
| PubChem CID | 135751960 |
| Molecular Formula | C19H17N5O7 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N-[(E)-(2-hydroxy-5-methoxy-3-nitrophenyl)methylideneamino]-2-(2-methyl-4-oxoquinazolin-3-yl)oxyacetamide |
| SMILES | COc1cc(/C=N/NC(=O)COn2c(C)nc3ccccc3c2=O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17N5O7/c1-11-21-15-6-4-3-5-14(15)19(27)23(11)31-10-17(25)22-20-9-12-7-13(30-2)8-16(18(12)26)24(28)29/h3-9,26H,10H2,1-2H3,(H,22,25)/b20-9+ |
| InChIKey | UORGKSXMGNEUKR-AWQFTUOYSA-N |
| XLogP | 0.91 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|