4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid

C7H5N3O3 — CID 135752495

IUPAC4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid
SMILESO=C(O)c1cc2c(=O)[nH]cnn2c1
InChIInChI=1S/C7H5N3O3/c11-6-5-1-4(7(12)13)2-10(5)9-3-8-6/h1-3H,(H,12,13)(H,8,9,11)
InChIKeyOJLSUKAKEXVXIM-UHFFFAOYSA-N
MW179.14 g/mol
LogP-0.28
Rot. Bonds1

About 4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid

4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid (PubChem CID 135752495) has the molecular formula C7H5N3O3 and a molecular weight of 179.14 g/mol. Its IUPAC name is 4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid.

Molecular Properties

Compound Name4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid
PubChem CID135752495
Molecular FormulaC7H5N3O3
Molecular Weight179.14 g/mol
Exact Mass179.03
IUPAC Name4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid
SMILESO=C(O)c1cc2c(=O)[nH]cnn2c1
InChIInChI=1S/C7H5N3O3/c11-6-5-1-4(7(12)13)2-10(5)9-3-8-6/h1-3H,(H,12,13)(H,8,9,11)
InChIKeyOJLSUKAKEXVXIM-UHFFFAOYSA-N
XLogP-0.28
TPSA87.46 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.14
LogP ≤ 5-0.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid?
The IUPAC name of 4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid (CID 135752495) is 4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid.
What is the SMILES notation for 4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid?
The canonical SMILES for 4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid is O=C(O)c1cc2c(=O)[nH]cnn2c1.
What is the InChIKey of 4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid?
The InChIKey is OJLSUKAKEXVXIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O3/c11-6-5-1-4(7(12)13)2-10(5)9-3-8-6/h1-3H,(H,12,13)(H,8,9,11).
What are the key properties of 4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid?
4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid has a molecular weight of 179.14 g/mol, XLogP of -0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid is sourced from PubChem (CID 135752495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).