4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid

C7H5N3O3 — CID 135408952

IUPAC4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid
SMILESO=C(O)c1c[nH]c2c(=O)[nH]cnc12
InChIInChI=1S/C7H5N3O3/c11-6-5-4(9-2-10-6)3(1-8-5)7(12)13/h1-2,8H,(H,12,13)(H,9,10,11)
InChIKeyHCRPEPKPPKRFIH-UHFFFAOYSA-N
MW179.13 g/mol
LogP-0.05
Rot. Bonds1

About 4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid

4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid (PubChem CID 135408952) has the molecular formula C7H5N3O3 and a molecular weight of 179.13 g/mol. Its IUPAC name is 4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid.

Molecular Properties

Compound Name4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid
PubChem CID135408952
Molecular FormulaC7H5N3O3
Molecular Weight179.13 g/mol
Exact Mass179.03
IUPAC Name4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid
SMILESO=C(O)c1c[nH]c2c(=O)[nH]cnc12
InChIInChI=1S/C7H5N3O3/c11-6-5-4(9-2-10-6)3(1-8-5)7(12)13/h1-2,8H,(H,12,13)(H,9,10,11)
InChIKeyHCRPEPKPPKRFIH-UHFFFAOYSA-N
XLogP-0.05
TPSA98.84 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.13
LogP ≤ 5-0.05
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid?
The IUPAC name of 4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid (CID 135408952) is 4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid.
What is the SMILES notation for 4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid?
The canonical SMILES for 4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid is O=C(O)c1c[nH]c2c(=O)[nH]cnc12.
What is the InChIKey of 4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid?
The InChIKey is HCRPEPKPPKRFIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O3/c11-6-5-4(9-2-10-6)3(1-8-5)7(12)13/h1-2,8H,(H,12,13)(H,9,10,11).
What are the key properties of 4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid?
4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid has a molecular weight of 179.13 g/mol, XLogP of -0.05, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3,5-dihydropyrrolo[3,2-d]pyrimidine-7-carboxylic acid is sourced from PubChem (CID 135408952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).