3-amino-1H-pyrrole-2,4-dicarboxylic acid

C6H6N2O4 — CID 22271869

IUPAC3-amino-1H-pyrrole-2,4-dicarboxylic acid
SMILESNc1c(C(=O)O)c[nH]c1C(=O)O
InChIInChI=1S/C6H6N2O4/c7-3-2(5(9)10)1-8-4(3)6(11)12/h1,8H,7H2,(H,9,10)(H,11,12)
InChIKeyXRXNPYRCHRBRTF-UHFFFAOYSA-N
MW170.12 g/mol
LogP-0.01
Rot. Bonds2

About 3-amino-1H-pyrrole-2,4-dicarboxylic acid

3-amino-1H-pyrrole-2,4-dicarboxylic acid (PubChem CID 22271869) has the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. Its IUPAC name is 3-amino-1H-pyrrole-2,4-dicarboxylic acid.

Molecular Properties

Compound Name3-amino-1H-pyrrole-2,4-dicarboxylic acid
PubChem CID22271869
Molecular FormulaC6H6N2O4
Molecular Weight170.12 g/mol
Exact Mass170.03
IUPAC Name3-amino-1H-pyrrole-2,4-dicarboxylic acid
SMILESNc1c(C(=O)O)c[nH]c1C(=O)O
InChIInChI=1S/C6H6N2O4/c7-3-2(5(9)10)1-8-4(3)6(11)12/h1,8H,7H2,(H,9,10)(H,11,12)
InChIKeyXRXNPYRCHRBRTF-UHFFFAOYSA-N
XLogP-0.01
TPSA116.41 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.12
LogP ≤ 5-0.01
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Analyze 3-amino-1H-pyrrole-2,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-1H-pyrrole-2,4-dicarboxylic acid?
The IUPAC name of 3-amino-1H-pyrrole-2,4-dicarboxylic acid (CID 22271869) is 3-amino-1H-pyrrole-2,4-dicarboxylic acid.
What is the SMILES notation for 3-amino-1H-pyrrole-2,4-dicarboxylic acid?
The canonical SMILES for 3-amino-1H-pyrrole-2,4-dicarboxylic acid is Nc1c(C(=O)O)c[nH]c1C(=O)O.
What is the InChIKey of 3-amino-1H-pyrrole-2,4-dicarboxylic acid?
The InChIKey is XRXNPYRCHRBRTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O4/c7-3-2(5(9)10)1-8-4(3)6(11)12/h1,8H,7H2,(H,9,10)(H,11,12).
What are the key properties of 3-amino-1H-pyrrole-2,4-dicarboxylic acid?
3-amino-1H-pyrrole-2,4-dicarboxylic acid has a molecular weight of 170.12 g/mol, XLogP of -0.01, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1H-pyrrole-2,4-dicarboxylic acid is sourced from PubChem (CID 22271869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).