About methyl 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxylate
methyl 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxylate (PubChem CID 57499744) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is methyl 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxylate.
Analyze methyl 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxylate?
The IUPAC name of methyl 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxylate (CID 57499744) is methyl 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxylate.
What is the SMILES notation for methyl 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxylate?
The canonical SMILES for methyl 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxylate is COC(=O)c1c[nH]c2c1NC=NC2.
What is the InChIKey of methyl 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxylate?
The InChIKey is PIXZXRUAILSETR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-13-8(12)5-2-10-6-3-9-4-11-7(5)6/h2,4,10H,3H2,1H3,(H,9,11).
What are the key properties of methyl 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxylate?
methyl 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxylate has a molecular weight of 179.18 g/mol, XLogP of 0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxylate is sourced from PubChem (CID 57499744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).