C9H8N4O2S — CID 135752733
N-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]pyridine-4-carboxamide (PubChem CID 135752733) has the molecular formula C9H8N4O2S and a molecular weight of 236.26 g/mol. Its IUPAC name is N-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135752733 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | N-[(Z)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]pyridine-4-carboxamide |
| SMILES | O=C1CS/C(=N\NC(=O)c2ccncc2)N1 |
| InChI | InChI=1S/C9H8N4O2S/c14-7-5-16-9(11-7)13-12-8(15)6-1-3-10-4-2-6/h1-4H,5H2,(H,12,15)(H,11,13,14) |
| InChIKey | GELLGPUDFMBDOD-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|