About Acetylisoniazid
Acetylisoniazid (PubChem CID 71602) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is N'-acetylpyridine-4-carbohydrazide.
Molecular Properties
| Compound Name | Acetylisoniazid |
| PubChem CID | 71602 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | N'-acetylpyridine-4-carbohydrazide |
| SMILES | CC(=O)NNC(=O)C1=CC=NC=C1 |
| InChI | InChI=1S/C8H9N3O2/c1-6(12)10-11-8(13)7-2-4-9-5-3-7/h2-5H,1H3,(H,10,12)(H,11,13) |
| InChIKey | CVBGNAKQQUWBQV-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 71.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | 200 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Acetylisoniazid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Acetylisoniazid?
The IUPAC name of Acetylisoniazid (CID 71602) is N'-acetylpyridine-4-carbohydrazide.
What is the SMILES notation for Acetylisoniazid?
The canonical SMILES for Acetylisoniazid is CC(=O)NNC(=O)C1=CC=NC=C1.
What is the InChIKey of Acetylisoniazid?
The InChIKey is CVBGNAKQQUWBQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-6(12)10-11-8(13)7-2-4-9-5-3-7/h2-5H,1H3,(H,10,12)(H,11,13).
What are the key properties of Acetylisoniazid?
Acetylisoniazid has a molecular weight of 179.18 g/mol, XLogP of -0.40, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Acetylisoniazid is sourced from PubChem (CID 71602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).