About phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide
phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide (PubChem CID 9367) has the molecular formula C9H16N3O5P
and a molecular weight of 277.22 g/mol. Its IUPAC name is phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide.
Molecular Properties
| Compound Name | phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide |
| PubChem CID | 9367 |
| Molecular Formula | C9H16N3O5P |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide |
| SMILES | CC(C)NNC(=O)c1ccncc1.O=P(O)(O)O |
| InChI | InChI=1S/C9H13N3O.H3O4P/c1-7(2)11-12-9(13)8-3-5-10-6-4-8;1-5(2,3)4/h3-7,11H,1-2H3,(H,12,13);(H3,1,2,3,4) |
| InChIKey | YPDVTKJXVHYWFY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide?
The IUPAC name of phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide (CID 9367) is phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide.
What is the SMILES notation for phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide?
The canonical SMILES for phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide is CC(C)NNC(=O)c1ccncc1.O=P(O)(O)O.
What is the InChIKey of phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide?
The InChIKey is YPDVTKJXVHYWFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O.H3O4P/c1-7(2)11-12-9(13)8-3-5-10-6-4-8;1-5(2,3)4/h3-7,11H,1-2H3,(H,12,13);(H3,1,2,3,4).
What are the key properties of phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide?
phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide has a molecular weight of 277.22 g/mol, XLogP of -0.20, 3 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phosphoric acid;N'-propan-2-ylpyridine-4-carbohydrazide is sourced from PubChem (CID 9367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).