C14H18ClN5O2 — CID 135753051
4-chloro-N-[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]butanamide (PubChem CID 135753051) has the molecular formula C14H18ClN5O2 and a molecular weight of 323.78 g/mol. Its IUPAC name is 4-chloro-N-[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]butanamide.
| Compound Name | 4-chloro-N-[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]butanamide |
|---|---|
| PubChem CID | 135753051 |
| Molecular Formula | C14H18ClN5O2 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-chloro-N-[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]butanamide |
| SMILES | CCc1cc(=O)[nH]c(-n2nc(C)cc2NC(=O)CCCCl)n1 |
| InChI | InChI=1S/C14H18ClN5O2/c1-3-10-8-13(22)18-14(16-10)20-11(7-9(2)19-20)17-12(21)5-4-6-15/h7-8H,3-6H2,1-2H3,(H,17,21)(H,16,18,22) |
| InChIKey | HJWOFBIOKDSYNK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|