C18H20N5O4- — CID 135753170
(1R,6S)-6-[[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]carbamoyl]cyclohex-3-ene-1-carboxylate (PubChem CID 135753170) has the molecular formula C18H20N5O4- and a molecular weight of 370.39 g/mol. Its IUPAC name is (1R,6S)-6-[[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]carbamoyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | (1R,6S)-6-[[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]carbamoyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 135753170 |
| Molecular Formula | C18H20N5O4- |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (1R,6S)-6-[[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]carbamoyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CCc1cc(=O)[nH]c(-n2nc(C)cc2NC(=O)[C@H]2CC=CC[C@H]2C(=O)[O-])n1 |
| InChI | InChI=1S/C18H21N5O4/c1-3-11-9-15(24)21-18(19-11)23-14(8-10(2)22-23)20-16(25)12-6-4-5-7-13(12)17(26)27/h4-5,8-9,12-13H,3,6-7H2,1-2H3,(H,20,25)(H,26,27)(H,19,21,24)/p-1/t12-,13+/m0/s1 |
| InChIKey | LYFPMABYKQSAJN-QWHCGFSZSA-M |
| XLogP | 0.10 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|