C17H22N6O4 — CID 135954086
N'-[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-(oxolan-2-ylmethyl)oxamide (PubChem CID 135954086) has the molecular formula C17H22N6O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is N'-[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-(oxolan-2-ylmethyl)oxamide.
| Compound Name | N'-[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-(oxolan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 135954086 |
| Molecular Formula | C17H22N6O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N'-[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-(oxolan-2-ylmethyl)oxamide |
| SMILES | CCc1cc(=O)[nH]c(-n2nc(C)cc2NC(=O)C(=O)NCC2CCCO2)n1 |
| InChI | InChI=1S/C17H22N6O4/c1-3-11-8-14(24)21-17(19-11)23-13(7-10(2)22-23)20-16(26)15(25)18-9-12-5-4-6-27-12/h7-8,12H,3-6,9H2,1-2H3,(H,18,25)(H,20,26)(H,19,21,24) |
| InChIKey | KCUCHEQFJGVNQE-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|