C21H30N6O3 — CID 136902200
N'-[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]oxamide (PubChem CID 136902200) has the molecular formula C21H30N6O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is N'-[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]oxamide.
| Compound Name | N'-[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]oxamide |
|---|---|
| PubChem CID | 136902200 |
| Molecular Formula | C21H30N6O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | N'-[2-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)-5-methylpyrazol-3-yl]-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]oxamide |
| SMILES | CCc1cc(=O)[nH]c(-n2nc(C)cc2NC(=O)C(=O)N[C@@H]2C[C@@H](C)CC(C)(C)C2)n1 |
| InChI | InChI=1S/C21H30N6O3/c1-6-14-9-17(28)25-20(23-14)27-16(8-13(3)26-27)24-19(30)18(29)22-15-7-12(2)10-21(4,5)11-15/h8-9,12,15H,6-7,10-11H2,1-5H3,(H,22,29)(H,24,30)(H,23,25,28)/t12-,15-/m1/s1 |
| InChIKey | ZVOVIBLMSHFQGQ-IUODEOHRSA-N |
| XLogP | 2.10 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|