C22H32N6O3 — CID 136641312
N'-[5-methyl-2-(6-oxo-4-propyl-1H-pyrimidin-2-yl)pyrazol-3-yl]-N-(3,3,5-trimethylcyclohexyl)oxamide (PubChem CID 136641312) has the molecular formula C22H32N6O3 and a molecular weight of 428.54 g/mol. Its IUPAC name is N'-[5-methyl-2-(6-oxo-4-propyl-1H-pyrimidin-2-yl)pyrazol-3-yl]-N-(3,3,5-trimethylcyclohexyl)oxamide.
| Compound Name | N'-[5-methyl-2-(6-oxo-4-propyl-1H-pyrimidin-2-yl)pyrazol-3-yl]-N-(3,3,5-trimethylcyclohexyl)oxamide |
|---|---|
| PubChem CID | 136641312 |
| Molecular Formula | C22H32N6O3 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N'-[5-methyl-2-(6-oxo-4-propyl-1H-pyrimidin-2-yl)pyrazol-3-yl]-N-(3,3,5-trimethylcyclohexyl)oxamide |
| SMILES | CCCc1cc(=O)[nH]c(-n2nc(C)cc2NC(=O)C(=O)NC2CC(C)CC(C)(C)C2)n1 |
| InChI | InChI=1S/C22H32N6O3/c1-6-7-15-10-18(29)26-21(24-15)28-17(9-14(3)27-28)25-20(31)19(30)23-16-8-13(2)11-22(4,5)12-16/h9-10,13,16H,6-8,11-12H2,1-5H3,(H,23,30)(H,25,31)(H,24,26,29) |
| InChIKey | ICZLBCPOWOCUCN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|