C8H6N2O3S — CID 135754393
(2E,5E)-5-(furan-2-ylmethylidene)-2-hydroxyimino-1,3-thiazolidin-4-one (PubChem CID 135754393) has the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. Its IUPAC name is (2E,5E)-5-(furan-2-ylmethylidene)-2-hydroxyimino-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-5-(furan-2-ylmethylidene)-2-hydroxyimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135754393 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | (2E,5E)-5-(furan-2-ylmethylidene)-2-hydroxyimino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\O)S/C1=C/c1ccco1 |
| InChI | InChI=1S/C8H6N2O3S/c11-7-6(14-8(9-7)10-12)4-5-2-1-3-13-5/h1-4,12H,(H,9,10,11)/b6-4+ |
| InChIKey | YZPLQXHXGWFQGB-GQCTYLIASA-N |
| XLogP | 1.23 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|