C8H8N4O4 — CID 135755332
2-(4,7-dioxo-3,5,6,8-tetrahydropteridin-6-yl)acetic acid (PubChem CID 135755332) has the molecular formula C8H8N4O4 and a molecular weight of 224.18 g/mol. Its IUPAC name is 2-(4,7-dioxo-3,5,6,8-tetrahydropteridin-6-yl)acetic acid.
| Compound Name | 2-(4,7-dioxo-3,5,6,8-tetrahydropteridin-6-yl)acetic acid |
|---|---|
| PubChem CID | 135755332 |
| Molecular Formula | C8H8N4O4 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-(4,7-dioxo-3,5,6,8-tetrahydropteridin-6-yl)acetic acid |
| SMILES | O=C(O)CC1Nc2c(nc[nH]c2=O)NC1=O |
| InChI | InChI=1S/C8H8N4O4/c13-4(14)1-3-7(15)12-6-5(11-3)8(16)10-2-9-6/h2-3,11H,1H2,(H,13,14)(H2,9,10,12,15,16) |
| InChIKey | MWJYPCAROPIBPJ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |