C10H13N5O4 — CID 136958961
2-[1-(5-amino-6-oxo-1H-pyrimidin-4-yl)-3-oxopiperazin-2-yl]acetic acid (PubChem CID 136958961) has the molecular formula C10H13N5O4 and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-[1-(5-amino-6-oxo-1H-pyrimidin-4-yl)-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1-(5-amino-6-oxo-1H-pyrimidin-4-yl)-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 136958961 |
| Molecular Formula | C10H13N5O4 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-[1-(5-amino-6-oxo-1H-pyrimidin-4-yl)-3-oxopiperazin-2-yl]acetic acid |
| SMILES | Nc1c(N2CCNC(=O)C2CC(=O)O)nc[nH]c1=O |
| InChI | InChI=1S/C10H13N5O4/c11-7-8(13-4-14-10(7)19)15-2-1-12-9(18)5(15)3-6(16)17/h4-5H,1-3,11H2,(H,12,18)(H,16,17)(H,13,14,19) |
| InChIKey | YWBODNSPGKETLS-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |