C24H26N2O2 — CID 135757849
1-[[(2R)-2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]iminomethyl]naphthalen-2-ol (PubChem CID 135757849) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 1-[[(2R)-2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]iminomethyl]naphthalen-2-ol.
| Compound Name | 1-[[(2R)-2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]iminomethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 135757849 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1-[[(2R)-2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]iminomethyl]naphthalen-2-ol |
| SMILES | COc1cccc([C@H](C/N=C/c2c(O)ccc3ccccc23)N2CCCC2)c1 |
| InChI | InChI=1S/C24H26N2O2/c1-28-20-9-6-8-19(15-20)23(26-13-4-5-14-26)17-25-16-22-21-10-3-2-7-18(21)11-12-24(22)27/h2-3,6-12,15-16,23,27H,4-5,13-14,17H2,1H3/b25-16+/t23-/m0/s1 |
| InChIKey | SQVWSFQZKCOEGT-AJPHYDNBSA-N |
| XLogP | 4.81 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|