C24H22N4O2 — CID 135760232
(2R)-6-amino-2-[4-[(2R)-butan-2-yl]phenyl]-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione (PubChem CID 135760232) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is (2R)-6-amino-2-[4-[(2R)-butan-2-yl]phenyl]-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione.
| Compound Name | (2R)-6-amino-2-[4-[(2R)-butan-2-yl]phenyl]-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione |
|---|---|
| PubChem CID | 135760232 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (2R)-6-amino-2-[4-[(2R)-butan-2-yl]phenyl]-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione |
| SMILES | CC[C@@H](C)c1ccc([C@@H]2C3=C(Nc4nc(N)[nH]c(=O)c42)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C24H22N4O2/c1-3-12(2)13-8-10-14(11-9-13)17-18-20(15-6-4-5-7-16(15)21(18)29)26-22-19(17)23(30)28-24(25)27-22/h4-12,17H,3H2,1-2H3,(H4,25,26,27,28,30)/t12-,17-/m1/s1 |
| InChIKey | SMVILGAUYCTKEA-SJKOYZFVSA-N |
| XLogP | 4.03 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |