C19H19ClN2O2 — CID 135765783
2-[4-(2-chlorophenyl)-1H-pyrazol-5-yl]-5-(2-methylpropoxy)phenol (PubChem CID 135765783) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)-1H-pyrazol-5-yl]-5-(2-methylpropoxy)phenol.
| Compound Name | 2-[4-(2-chlorophenyl)-1H-pyrazol-5-yl]-5-(2-methylpropoxy)phenol |
|---|---|
| PubChem CID | 135765783 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-[4-(2-chlorophenyl)-1H-pyrazol-5-yl]-5-(2-methylpropoxy)phenol |
| SMILES | CC(C)COc1ccc(-c2[nH]ncc2-c2ccccc2Cl)c(O)c1 |
| InChI | InChI=1S/C19H19ClN2O2/c1-12(2)11-24-13-7-8-15(18(23)9-13)19-16(10-21-22-19)14-5-3-4-6-17(14)20/h3-10,12,23H,11H2,1-2H3,(H,21,22) |
| InChIKey | HBZUIVZCOWUDBF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |