C23H19ClN2O2 — CID 135796160
2-[4-(2-chlorophenyl)-1H-pyrazol-5-yl]-5-[(4-methylphenyl)methoxy]phenol (PubChem CID 135796160) has the molecular formula C23H19ClN2O2 and a molecular weight of 390.87 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)-1H-pyrazol-5-yl]-5-[(4-methylphenyl)methoxy]phenol.
| Compound Name | 2-[4-(2-chlorophenyl)-1H-pyrazol-5-yl]-5-[(4-methylphenyl)methoxy]phenol |
|---|---|
| PubChem CID | 135796160 |
| Molecular Formula | C23H19ClN2O2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 2-[4-(2-chlorophenyl)-1H-pyrazol-5-yl]-5-[(4-methylphenyl)methoxy]phenol |
| SMILES | Cc1ccc(COc2ccc(-c3[nH]ncc3-c3ccccc3Cl)c(O)c2)cc1 |
| InChI | InChI=1S/C23H19ClN2O2/c1-15-6-8-16(9-7-15)14-28-17-10-11-19(22(27)12-17)23-20(13-25-26-23)18-4-2-3-5-21(18)24/h2-13,27H,14H2,1H3,(H,25,26) |
| InChIKey | UGFYXJVONNXYHF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |